Difference between revisions of "SJ03262"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-HIS-tRNAs Charged-HIS-tRNAs] == * common-name: ** an l-histidyl-[trnahis] == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == |
* common-name: | * common-name: | ||
| − | ** | + | ** amino-parathion |
| + | * smiles: | ||
| + | ** ccop(oc1(c=cc(=cc=1)n))(occ)=s | ||
| + | * inchi-key: | ||
| + | ** xizotxgjxstqdi-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 261.275 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=amino-parathion}} |
| + | {{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=261.275}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite AMINO-PARATHION
- common-name:
- amino-parathion
- smiles:
- ccop(oc1(c=cc(=cc=1)n))(occ)=s
- inchi-key:
- xizotxgjxstqdi-uhfffaoysa-n
- molecular-weight:
- 261.275
