Difference between revisions of "SJ03270"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannose
+
** kanamycin a
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
* inchi-key:
** mvmscbbuihutgj-gdjbgnaasa-l
+
** sbujhosqtjfqjx-noamyhissa-r
 
* molecular-weight:
 
* molecular-weight:
** 603.329
+
** 488.534
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.142-RXN]]
+
* [[RXN-13167]]
* [[2.4.1.83-RXN]]
+
* [[RXN-15285]]
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
* [[GDPMANDEHYDRA-RXN]]
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[RXN-16602]]
 
* [[RXN-1882]]
 
* [[RXN-5462]]
 
* [[RXN-5463]]
 
* [[RXN-5464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[RXN-1882]]
 
* [[RXN4FS-12]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannose}}
+
{{#set: common-name=kanamycin a}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
+
{{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}}
{{#set: molecular-weight=603.329}}
+
{{#set: molecular-weight=488.534}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-4821

  • common-name:
    • kanamycin a
  • smiles:
    • c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • sbujhosqtjfqjx-noamyhissa-r
  • molecular-weight:
    • 488.534

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality