Difference between revisions of "SJ03270"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-224 CPD-224] ==
 * common-name:
-** kanamycin a
+** a dolichyl diphosphate
-* smiles:
-** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
-* inchi-key:
-** sbujhosqtjfqjx-noamyhissa-r
-* molecular-weight:
-** 488.534
 == Reaction(s) known to consume the compound ==
-* [[RXN-13167]]
+* [[DOLICHYLDIPHOSPHATASE-RXN]]
-* [[RXN-15285]]
+* [[RXN-16761]]
 == Reaction(s) known to produce the compound ==
+* [[2.4.1.119-RXN]]
+* [[DOLICHYLDIPHOSPHATASE-RXN]]
+* [[RXN-16761]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=kanamycin a}}
+{{#set: common-name=a dolichyl diphosphate}}
-{{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}}
-{{#set: molecular-weight=488.534}}