Difference between revisions of "SJ03332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-403 CPD-403] == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=...")
(Created page with "Category:gene == Gene SJ03332 == * transcription-direction: ** positive * right-end-position: ** 108545 * left-end-position: ** 102701 * centisome-position: ** 83.962296...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-403 CPD-403] ==
+
== Gene SJ03332 ==
* common-name:
+
* transcription-direction:
** 3-hydroxy-4-methylanthranilate
+
** positive
* smiles:
+
* right-end-position:
** cc1(=cc=c(c(=c1o)n)c([o-])=o)
+
** 108545
* inchi-key:
+
* left-end-position:
** oyzonaxdawhdmn-uhfffaoysa-m
+
** 102701
* molecular-weight:
+
* centisome-position:
** 166.156
+
** 83.962296   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17077]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17077]]
+
* [[RXN-15559]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=3-hydroxy-4-methylanthranilate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=oyzonaxdawhdmn-uhfffaoysa-m}}
+
* [[RXN-15560]]
{{#set: molecular-weight=166.156}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=108545}}
 +
{{#set: left-end-position=102701}}
 +
{{#set: centisome-position=83.962296    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ03332

  • transcription-direction:
    • positive
  • right-end-position:
    • 108545
  • left-end-position:
    • 102701
  • centisome-position:
    • 83.962296

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway