Difference between revisions of "SJ03341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * common-name: ** benzoylsuccinyl-coa * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8815 CPD-8815] == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8815 CPD-8815] ==
 
* common-name:
 
* common-name:
** benzoylsuccinyl-coa
+
** 2,4-dihydroxybenzoate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc1(=cc(=c(c=c1)c([o-])=o)o)
 
* inchi-key:
 
* inchi-key:
** sgnpjinsckfitg-ihebcorqsa-i
+
** njesaxzanhetjv-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 966.676
+
** 151.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10078]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-905]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzoylsuccinyl-coa}}
+
{{#set: common-name=2,4-dihydroxybenzoate}}
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
+
{{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}}
{{#set: molecular-weight=966.676}}
+
{{#set: molecular-weight=151.141}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-8815

  • common-name:
    • 2,4-dihydroxybenzoate
  • smiles:
    • cc1(=cc(=c(c=c1)c([o-])=o)o)
  • inchi-key:
    • njesaxzanhetjv-uhfffaoysa-m
  • molecular-weight:
    • 151.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality