Difference between revisions of "SJ03349"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] == * common-name: ** a [histone]-n6-acetyl-l-lysin...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-DIPHOSPHATE OCTAPRENYL-DIPHOSPHATE] == * common-name: ** all-trans-octaprenyl diphos...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-DIPHOSPHATE OCTAPRENYL-DIPHOSPHATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-octaprenyl diphosphate |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** ikkldissulffqo-djmiluhssa-k | ||
| + | * molecular-weight: | ||
| + | ** 719.897 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-octaprenyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}} | ||
| + | {{#set: molecular-weight=719.897}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-octaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ikkldissulffqo-djmiluhssa-k
- molecular-weight:
- 719.897
