Difference between revisions of "SJ03386"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop(...")
(Created page with "Category:gene == Gene SJ03386 == * transcription-direction: ** negative * right-end-position: ** 269630 * left-end-position: ** 265812 * centisome-position: ** 50.59077...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+
== Gene SJ03386 ==
* common-name:
+
* transcription-direction:
** thiamine phosphate
+
** negative
* smiles:
+
* right-end-position:
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** 269630
* inchi-key:
+
* left-end-position:
** hzsajdvwzrbgif-uhfffaoysa-m
+
** 265812
* molecular-weight:
+
* centisome-position:
** 343.317
+
** 50.59077   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-3542]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-12610]]
+
* [[3.1.3.16-RXN]]
* [[RXN-12611]]
+
** Category: [[annotation]]
* [[RXN0-3542]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[THI-P-SYN-RXN]]
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=thiamine phosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
+
* [[PROTEIN-KINASE-RXN]]
{{#set: molecular-weight=343.317}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=269630}}
 +
{{#set: left-end-position=265812}}
 +
{{#set: centisome-position=50.59077    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:02, 18 March 2021

Gene SJ03386

  • transcription-direction:
    • negative
  • right-end-position:
    • 269630
  • left-end-position:
    • 265812
  • centisome-position:
    • 50.59077

Organism(s) associated with this gene

Reaction(s) associated