Difference between revisions of "SJ03392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(...")
(Created page with "Category:gene == Gene SJ03392 == * transcription-direction: ** positive * right-end-position: ** 374015 * left-end-position: ** 361297 * centisome-position: ** 68.76399...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] ==
+
== Gene SJ03392 ==
* common-name:
+
* transcription-direction:
** dttp
+
** positive
* smiles:
+
* right-end-position:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
+
** 374015
* inchi-key:
+
* left-end-position:
** nhvnxkfizysceb-xlpzgreqsa-j
+
** 361297
* molecular-weight:
+
* centisome-position:
** 478.139
+
** 68.76399   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DTTGY]]
+
* [[S.japonica_carotenoid_curated]]
* [[DTTPtm]]
+
== Reaction(s) associated ==
* [[DTTUP]]
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[RXN-14200]]
+
** Category: [[annotation]]
* [[RXN0-5107]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[ATDTD]]
+
{{#set: transcription-direction=positive}}
* [[ATDTDm]]
+
{{#set: right-end-position=374015}}
* [[DTDPKIN-RXN]]
+
{{#set: left-end-position=361297}}
* [[DTTPtm]]
+
{{#set: centisome-position=68.76399    }}
== Reaction(s) of unknown directionality ==
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: common-name=dttp}}
+
{{#set: nb reaction associated=1}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
 
{{#set: molecular-weight=478.139}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ03392

  • transcription-direction:
    • positive
  • right-end-position:
    • 374015
  • left-end-position:
    • 361297
  • centisome-position:
    • 68.76399

Organism(s) associated with this gene

Reaction(s) associated