Difference between revisions of "SJ03392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9896 CPD-9896] == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9896 CPD-9896] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
+
** dttp
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
+
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
 
* inchi-key:
 
* inchi-key:
** fmsczymouyoenk-opsrswoasa-m
+
** nhvnxkfizysceb-xlpzgreqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 766.178
+
** 478.139
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9281]]
+
* [[DTTGY]]
 +
* [[DTTPtm]]
 +
* [[DTTUP]]
 +
* [[RXN-14200]]
 +
* [[RXN0-5107]]
 +
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ATDTD]]
 +
* [[ATDTDm]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTTPtm]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
+
{{#set: common-name=dttp}}
{{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}}
+
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
{{#set: molecular-weight=766.178}}
+
{{#set: molecular-weight=478.139}}

Revision as of 14:20, 26 August 2019

Metabolite TTP

  • common-name:
    • dttp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
  • inchi-key:
    • nhvnxkfizysceb-xlpzgreqsa-j
  • molecular-weight:
    • 478.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality