Difference between revisions of "SJ03392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] ==
 
* common-name:
 
* common-name:
** dttp
+
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
+
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
 
* inchi-key:
 
* inchi-key:
** nhvnxkfizysceb-xlpzgreqsa-j
+
** llvvmxfnkahvez-gawnparcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 478.139
+
** 350.235
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTTGY]]
 
* [[DTTPtm]]
 
* [[DTTUP]]
 
* [[RXN-14200]]
 
* [[RXN0-5107]]
 
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDTD]]
+
* [[RXN-14897]]
* [[ATDTDm]]
 
* [[DTDPKIN-RXN]]
 
* [[DTTPtm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dttp}}
+
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
+
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
{{#set: molecular-weight=478.139}}
+
{{#set: molecular-weight=350.235}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-11241

  • common-name:
    • 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
  • smiles:
    • c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
  • inchi-key:
    • llvvmxfnkahvez-gawnparcsa-l
  • molecular-weight:
    • 350.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality