Difference between revisions of "SJ03392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturo...")
(Created page with "Category:gene == Gene SJ10722 == * transcription-direction: ** negative * right-end-position: ** 165016 * left-end-position: ** 156289 * centisome-position: ** 40.605934...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] ==
+
== Gene SJ10722 ==
−
* common-name:
+
* transcription-direction:
−
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
+
** 165016
−
* inchi-key:
+
* left-end-position:
−
** llvvmxfnkahvez-gawnparcsa-l
+
** 156289
−
* molecular-weight:
+
* centisome-position:
−
** 350.235
+
** 40.605934   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-14897]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=350.235}}
+
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=165016}}
 +
{{#set: left-end-position=156289}}
 +
{{#set: centisome-position=40.605934    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ10722

  • transcription-direction:
    • negative
  • right-end-position:
    • 165016
  • left-end-position:
    • 156289
  • centisome-position:
    • 40.605934

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ03392&oldid=41463"