Difference between revisions of "SJ03411"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(...")
(Created page with "Category:gene == Gene SJ03411 == * transcription-direction: ** negative * right-end-position: ** 97132 * left-end-position: ** 88058 * centisome-position: ** 72.46021...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] ==
+
== Gene SJ03411 ==
* common-name:
+
* transcription-direction:
** keto-phenylpyruvate
+
** negative
* smiles:
+
* right-end-position:
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
+
** 97132
* inchi-key:
+
* left-end-position:
** btnmpgbkdvtsjy-uhfffaoysa-m
+
** 88058
* molecular-weight:
+
* centisome-position:
** 163.152
+
** 72.46021   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.6.1.64-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[PHEAMINOTRANS-RXN]]
+
== Reaction(s) associated ==
* [[PREPHENATEDEHYDRAT-RXN]]
+
* [[2.7.10.1-RXN]]
* [[RXN-10814]]
+
** Category: [[annotation]]
* [[RXN-10815]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
* [[2.7.12.1-RXN]]
* [[2.6.1.64-RXN]]
+
** Category: [[annotation]]
* [[PHEAMINOTRANS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PPDH]]
+
* [[PROTEIN-KINASE-RXN]]
* [[PREPHENATEDEHYDRAT-RXN]]
+
** Category: [[annotation]]
* [[RXN-10814]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-17130]]
+
* [[RXN-14906]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=keto-phenylpyruvate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=163.152}}
+
{{#set: right-end-position=97132}}
 +
{{#set: left-end-position=88058}}
 +
{{#set: centisome-position=72.46021    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:00, 18 March 2021

Gene SJ03411

  • transcription-direction:
    • negative
  • right-end-position:
    • 97132
  • left-end-position:
    • 88058
  • centisome-position:
    • 72.46021

Organism(s) associated with this gene

Reaction(s) associated