Difference between revisions of "SJ03411"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-CarboxyMeAmMe-2-O-MeU34-tRNALeu 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu] == * common-name: ** a 5-c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** keto-phenylpyruvate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) | ||
| + | * inchi-key: | ||
| + | ** btnmpgbkdvtsjy-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 163.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.6.1.64-RXN]] | ||
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[PREPHENATEDEHYDRAT-RXN]] | ||
| + | * [[RXN-10814]] | ||
| + | * [[RXN-10815]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.6.1.64-RXN]] |
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[PPDH]] | ||
| + | * [[PREPHENATEDEHYDRAT-RXN]] | ||
| + | * [[RXN-10814]] | ||
| + | * [[RXN-17130]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=keto-phenylpyruvate}} |
| + | {{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=163.152}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite PHENYL-PYRUVATE
- common-name:
- keto-phenylpyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cc=cc=c1)
- inchi-key:
- btnmpgbkdvtsjy-uhfffaoysa-m
- molecular-weight:
- 163.152
