Difference between revisions of "SJ03475"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8166 CPD-8166] == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8166 CPD-8166] ==
 
* common-name:
 
* common-name:
** guanosine 2',3'-cyclic monophosphate
+
** 1-18:2-2-18:3-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
* inchi-key:
** uasryodfrywbrc-uuokfmhzsa-m
+
** drlqfbrxasrgdp-bubqrnscsa-n
 
* molecular-weight:
 
* molecular-weight:
** 344.2
+
** 777.089
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12058]]
+
* [[RXN-8368]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8367]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
+
{{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}}
{{#set: molecular-weight=344.2}}
+
{{#set: molecular-weight=777.089}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8166

  • common-name:
    • 1-18:2-2-18:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • drlqfbrxasrgdp-bubqrnscsa-n
  • molecular-weight:
    • 777.089

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality