Difference between revisions of "SJ03511"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sc...")
(Created page with "Category:gene == Gene SJ03511 == * transcription-direction: ** positive * right-end-position: ** 34876 * left-end-position: ** 24015 * centisome-position: ** 20.033703...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
+
== Gene SJ03511 ==
* common-name:
+
* transcription-direction:
** palmitoleoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 34876
* inchi-key:
+
* left-end-position:
** qbyoccwnzaoztl-mdmkaecgsa-j
+
** 24015
* molecular-weight:
+
* centisome-position:
** 999.899
+
** 20.033703   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-10662]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-17008]]
+
== Reaction(s) associated ==
* [[RXN-17009]]
+
* [[3.2.1.84-RXN]]
* [[RXN-17019]]
+
** Category: [[annotation]]
* [[RXN-17788]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-9616]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-10664]]
+
* [[ALPHAGALACTOSID-RXN]]
* [[RXN-17787]]
+
** Category: [[orthology]]
* [[RXN0-7248]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=palmitoleoyl-coa}}
+
* [[RXN-15910]]
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
+
** Category: [[orthology]]
{{#set: molecular-weight=999.899}}
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY0-1301]]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
* [[PWY-842]]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=34876}}
 +
{{#set: left-end-position=24015}}
 +
{{#set: centisome-position=20.033703    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ03511

  • transcription-direction:
    • positive
  • right-end-position:
    • 34876
  • left-end-position:
    • 24015
  • centisome-position:
    • 20.033703

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY0-1301
    • 1 reactions found over 1 reactions in the full pathway
  • PWY-842
    • 1 reactions found over 3 reactions in the full pathway