Difference between revisions of "SJ03511"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3486 CPD-3486] == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == |
* common-name: | * common-name: | ||
− | ** | + | ** palmitoleoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qbyoccwnzaoztl-mdmkaecgsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 999.899 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10662]] | ||
+ | * [[RXN-17008]] | ||
+ | * [[RXN-17009]] | ||
+ | * [[RXN-17019]] | ||
+ | * [[RXN-17788]] | ||
+ | * [[RXN-9616]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10664]] |
+ | * [[RXN-17787]] | ||
+ | * [[RXN0-7248]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=palmitoleoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=999.899}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-10269
- common-name:
- palmitoleoyl-coa
- smiles:
- ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- qbyoccwnzaoztl-mdmkaecgsa-j
- molecular-weight:
- 999.899