Difference between revisions of "SJ03520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D19-C38-ACPs trans-D2-cis-D19-C38-ACPs] == * common-name: ** a trans-delta2-cis-de...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D19-C38-ACPs trans-D2-cis-D19-C38-ACPs] ==
 
* common-name:
 
* common-name:
** (+)-pinobanksin
+
** a trans-delta2-cis-delta19-c38:2-[acp]
* smiles:
 
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
 
* inchi-key:
 
** suyjzkrqhbqnca-lsdhhaiusa-m
 
* molecular-weight:
 
** 271.249
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7648]]
+
* [[RXN1G-1084]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-pinobanksin}}
+
{{#set: common-name=a trans-delta2-cis-delta19-c38:2-[acp]}}
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
 
{{#set: molecular-weight=271.249}}
 

Revision as of 09:23, 27 August 2019

Metabolite trans-D2-cis-D19-C38-ACPs

  • common-name:
    • a trans-delta2-cis-delta19-c38:2-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-delta2-cis-delta19-c38:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.