Difference between revisions of "SJ03591"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08897 == * transcription-direction: ** positive * right-end-position: ** 28477 * left-end-position: ** 26993 * centisome-position: ** 57.449024...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == |
− | * | + | * common-name: |
− | ** | + | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin |
− | * | + | * smiles: |
− | ** | + | ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) |
− | * | + | * inchi-key: |
− | ** | + | ** ghrbcdhnysufrn-iuyqgcfvsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 223.234 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15733]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} | |
− | + | {{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=223.234}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-16953
- common-name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- smiles:
- cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- ghrbcdhnysufrn-iuyqgcfvsa-n
- molecular-weight:
- 223.234
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.