Difference between revisions of "SJ03592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=...")
(Created page with "Category:gene == Gene SJ03592 == * transcription-direction: ** positive * right-end-position: ** 116538 * left-end-position: ** 110984 * centisome-position: ** 93.660545...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Gene SJ03592 ==
−
* common-name:
+
* transcription-direction:
−
** β-d-ribose 5-phosphate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
+
** 116538
−
* inchi-key:
+
* left-end-position:
−
** ktvpxoyakdprhy-txicztdvsa-l
+
** 110984
−
* molecular-weight:
+
* centisome-position:
−
** 228.095
+
** 93.660545   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
{{#set: common-name=&beta;-d-ribose 5-phosphate}}
+
* [[2.7.10.1-RXN]]
−
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=228.095}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[2.7.11.24-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[2.7.12.1-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[2.7.12.2-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-16317]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
</div>
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=116538}}
 +
{{#set: left-end-position=110984}}
 +
{{#set: centisome-position=93.660545    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=7}}

Latest revision as of 11:03, 18 March 2021

Gene SJ03592

  • transcription-direction:
    • positive
  • right-end-position:
    • 116538
  • left-end-position:
    • 110984
  • centisome-position:
    • 93.660545

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ03592&oldid=132885"