Difference between revisions of "SJ03592"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == * common-name: ** an l-cysteine-s-conju...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-ribose 5-phosphate |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) | ||
| + | * inchi-key: | ||
| + | ** ktvpxoyakdprhy-txicztdvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-ribose 5-phosphate}} |
| + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-16551
- common-name:
- β-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi-key:
- ktvpxoyakdprhy-txicztdvsa-l
- molecular-weight:
- 228.095
