Difference between revisions of "SJ03645"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-seryl-Protein L-methionyl-L-seryl-Protein] == * common-name: ** an n-terminal-l-m...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-isopropyl-9-(methylthio)-2-oxononanoate |
| + | * smiles: | ||
| + | ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** pbyokogrhhzthq-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 260.304 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18202]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18202]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-9-(methylthio)-2-oxononanoate}} |
| + | {{#set: inchi-key=inchikey=pbyokogrhhzthq-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=260.304}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-19488
- common-name:
- 3-isopropyl-9-(methylthio)-2-oxononanoate
- smiles:
- csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- pbyokogrhhzthq-uhfffaoysa-l
- molecular-weight:
- 260.304
