Difference between revisions of "SJ03645"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-6 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zventdgzqvbwna-rciygobdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 582.908 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9220]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-6}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=582.908}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-12124
- common-name:
- menaquinol-6
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
- inchi-key:
- zventdgzqvbwna-rciygobdsa-n
- molecular-weight:
- 582.908
