Difference between revisions of "SJ03663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * common-name: ** β-l-arabinose 1-phosphate * smiles: ** c1(oc(c(c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-l-arabinose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ilxhfxfppzgenn-qmkxcqhvsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 228.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[UMPU]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-l-arabinose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-qmkxcqhvsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.095}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-1825
- common-name:
- β-l-arabinose 1-phosphate
- smiles:
- c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-])
- inchi-key:
- ilxhfxfppzgenn-qmkxcqhvsa-l
- molecular-weight:
- 228.095
