Difference between revisions of "SJ03721"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-omega-dimethyl-arginine Protein-N-omega-dimethyl-arginine] == * common-name: ** [prot...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-omega-dimethyl-arginine Protein-N-omega-dimethyl-arginine] ==
 
* common-name:
 
* common-name:
** linustatin
+
** [protein]-nω,nω-dimethyl-l-arginine
* smiles:
 
** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
 
* inchi-key:
 
** fersmfqbwvbkqk-cxttvelosa-n
 
* molecular-weight:
 
** 409.389
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13602]]
+
* [[RXN-17121]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16891]]
 +
* [[RXN-17121]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=linustatin}}
+
{{#set: common-name=[protein]-nω,nω-dimethyl-l-arginine}}
{{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}}
 
{{#set: molecular-weight=409.389}}
 

Revision as of 09:24, 27 August 2019

Metabolite Protein-N-omega-dimethyl-arginine

  • common-name:
    • [protein]-nω,nω-dimethyl-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "protein]-nω,nω-dimethyl-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.