Difference between revisions of "SJ03824"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sc...")
(Created page with "Category:gene == Gene SJ13427 == * transcription-direction: ** positive * right-end-position: ** 293314 * left-end-position: ** 291122 * centisome-position: ** 86.43585...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
+
== Gene SJ13427 ==
−
* common-name:
+
* transcription-direction:
−
** 5-methylhex-4-enoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 293314
−
* inchi-key:
+
* left-end-position:
−
** beyylhumfmwplh-svhodsnwsa-j
+
** 291122
−
* molecular-weight:
+
* centisome-position:
−
** 873.658
+
** 86.43585   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-11917]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
−
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=873.658}}
+
== Pathway(s) associated ==
 +
* [[NAGLIPASYN-PWY]]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=293314}}
 +
{{#set: left-end-position=291122}}
 +
{{#set: centisome-position=86.43585    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 09:25, 27 August 2019

Gene SJ13427

  • transcription-direction:
    • positive
  • right-end-position:
    • 293314
  • left-end-position:
    • 291122
  • centisome-position:
    • 86.43585

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ03824&oldid=29229"