Difference between revisions of "SJ03844"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-hexadec-7-enoyl-ACPs 7Z-hexadec-7-enoyl-ACPs] == * common-name: ** a (7z)-hexadec-7-enoyl-[a...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * common-name: ** nigerose * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** nigerose |
| + | * smiles: | ||
| + | ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) | ||
| + | * inchi-key: | ||
| + | ** qigjyvcqydkydw-nsyytrpssa-n | ||
| + | * molecular-weight: | ||
| + | ** 342.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5395]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nigerose}} |
| + | {{#set: inchi-key=inchikey=qigjyvcqydkydw-nsyytrpssa-n}} | ||
| + | {{#set: molecular-weight=342.299}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite 3-BETA-D-GLUCOSYLGLUCOSE
- common-name:
- nigerose
- smiles:
- c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2)
- inchi-key:
- qigjyvcqydkydw-nsyytrpssa-n
- molecular-weight:
- 342.299
