Difference between revisions of "SJ03901"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLAMINE DIMETHYLAMINE] == * common-name: ** dimethylamine * smiles: ** c[n+]c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-galactose |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqzgkkkjijffok-fprjbgldsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ALDOSE1EPIM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| + | * [[BETAGALACTOSID-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-galactose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite GALACTOSE
- common-name:
- β-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-fprjbgldsa-n
- molecular-weight:
- 180.157
