Difference between revisions of "SJ03963"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co *...") |
(Created page with "Category:gene == Gene SJ03963 == * transcription-direction: ** negative * right-end-position: ** 8194 * left-end-position: ** 4938 * centisome-position: ** 4.3244095 =...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ03963 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 8194 |
− | * | + | * left-end-position: |
− | ** | + | ** 4938 |
− | * | + | * centisome-position: |
− | ** | + | ** 4.3244095 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | * [[ | + | * [[2.7.10.1-RXN]] |
− | + | ** Category: [[orthology]] | |
− | {{#set: | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | {{#set: | + | * [[PROTEIN-KINASE-RXN]] |
− | {{#set: | + | ** Category: [[annotation]] |
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | ** Category: [[orthology]] | ||
+ | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
+ | {{#set: transcription-direction=negative}} | ||
+ | {{#set: right-end-position=8194}} | ||
+ | {{#set: left-end-position=4938}} | ||
+ | {{#set: centisome-position=4.3244095 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=2}} |
Latest revision as of 11:03, 18 March 2021
Gene SJ03963
- transcription-direction:
- negative
- right-end-position:
- 8194
- left-end-position:
- 4938
- centisome-position:
- 4.3244095
Organism(s) associated with this gene
Reaction(s) associated
- 2.7.10.1-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
- PROTEIN-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation