Difference between revisions of "SJ03963"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14746 CPD-14746] == * common-name: ** thiobenzoate * smiles: ** c(c1(c=cc=cc=1))(s)=o * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14746 CPD-14746] == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiobenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(c=cc=cc=1))(s)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uijgntrupzpvng-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 138.184 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13725]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiobenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uijgntrupzpvng-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.184}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-14746
- common-name:
- thiobenzoate
- smiles:
- c(c1(c=cc=cc=1))(s)=o
- inchi-key:
- uijgntrupzpvng-uhfffaoysa-n
- molecular-weight:
- 138.184
