Difference between revisions of "SJ03966"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] == * common-name: ** a menaquinol == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] == * common-name: ** 2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] ==
 
* common-name:
 
* common-name:
** a menaquinol
+
** 2-c-methyl-d-erythritol 4-phosphate
 +
* smiles:
 +
** cc(o)(co)c(o)cop([o-])([o-])=o
 +
* inchi-key:
 +
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
 +
* molecular-weight:
 +
** 214.111
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14107]]
+
* [[2.7.7.60-RXN]]
 +
* [[DXPREDISOM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11046]]
+
* [[DXPREDISOM-RXN]]
* [[RXN-15740]]
 
* [[RXN0-6554]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a menaquinol}}
+
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
 +
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}
 +
{{#set: molecular-weight=214.111}}

Revision as of 09:23, 27 August 2019

Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol 4-phosphate
  • smiles:
    • cc(o)(co)c(o)cop([o-])([o-])=o
  • inchi-key:
    • xmwhrvnvkdkbrg-uhnvwzdzsa-l
  • molecular-weight:
    • 214.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality