Difference between revisions of "SJ03966"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * common-name: ** theobromine * smiles: ** cn2(c=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] == * common-name: ** a menaquinol == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] ==
 
* common-name:
 
* common-name:
** theobromine
+
** a menaquinol
* smiles:
 
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 
* inchi-key:
 
** yapqbxqyljrxsa-uhfffaoysa-n
 
* molecular-weight:
 
** 180.166
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11519]]
+
* [[RXN-14107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11046]]
 +
* [[RXN-15740]]
 +
* [[RXN0-6554]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=theobromine}}
+
{{#set: common-name=a menaquinol}}
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
 
{{#set: molecular-weight=180.166}}
 

Revision as of 14:19, 26 August 2019

Metabolite Menaquinols

  • common-name:
    • a menaquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality