Difference between revisions of "SJ03976"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZQ OCTAPRENYL-METHYL-METHOXY-BENZQ] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ox-Disulfides Protein-Ox-Disulfides] ==
 * common-name:
-** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
+** a protein with oxidized disulfide bonds
-* smiles:
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
-* inchi-key:
-** hdsgdgslnmimku-kfsstaeesa-n
-* molecular-weight:
-** 699.111
 == Reaction(s) known to consume the compound ==
+* [[DISULFOXRED-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+* [[DISULFOXRED-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
+{{#set: common-name=a protein with oxidized disulfide bonds}}
-{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
-{{#set: molecular-weight=699.111}}