Difference between revisions of "SJ04004"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** ccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** homogentisate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** igmnyecmumzddf-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 167.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14929]] | |
− | * [[RXN- | + | * [[RXN-2541]] |
− | * [[RXN- | + | * [[RXN-2761]] |
− | * [[ | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] |
− | * [[ | + | * [[HPPD]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=homogentisate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.141}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite HOMOGENTISATE
- common-name:
- homogentisate
- smiles:
- c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
- inchi-key:
- igmnyecmumzddf-uhfffaoysa-m
- molecular-weight:
- 167.141