Difference between revisions of "SJ04123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15838 CPD-15838] == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dietary-retinyl-esters Dietary-retinyl-esters] == * common-name: ** a dietary all-trans-retinyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15838 CPD-15838] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dietary-retinyl-esters Dietary-retinyl-esters] ==
 
* common-name:
 
* common-name:
** γ-tocotrienol
+
** a dietary all-trans-retinyl ester
* smiles:
 
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
 
* inchi-key:
 
** otxntmvvoobzcv-wazjvijmsa-n
 
* molecular-weight:
 
** 410.639
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14918]]
+
* [[RXN-12579]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-tocotrienol}}
+
{{#set: common-name=a dietary all-trans-retinyl ester}}
{{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}}
 
{{#set: molecular-weight=410.639}}
 

Revision as of 14:20, 26 August 2019

Metabolite Dietary-retinyl-esters

  • common-name:
    • a dietary all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality