Difference between revisions of "SJ04185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * common-name: ** n-acetylglutamyl-phosphate * smil...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Angiotensinogens Angiotensinogens] == * common-name: ** an angiotensinogen == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Angiotensinogens Angiotensinogens] ==
 
* common-name:
 
* common-name:
** n-acetylglutamyl-phosphate
+
** an angiotensinogen
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
** fcvihfvsxhopsw-yfkpbyrvsa-k
 
* molecular-weight:
 
** 266.124
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[3.4.23.15-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
 
* [[AGK]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetylglutamyl-phosphate}}
+
{{#set: common-name=an angiotensinogen}}
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
 
{{#set: molecular-weight=266.124}}
 

Revision as of 09:23, 27 August 2019

Metabolite Angiotensinogens

  • common-name:
    • an angiotensinogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality