Difference between revisions of "SJ04242"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * common-name: ** aldehydo-d-ribose 5-phosphate * smiles: ** [ch](=o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
 
* common-name:
 
* common-name:
** gdp-β-l-galactose
+
** aldehydo-d-ribose 5-phosphate
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
+
** [ch](=o)c(o)c(o)c(cop([o-])([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** mvmscbbuihutgj-jgqubwhwsa-l
+
** ppqronhoshzgfq-lmvfsukvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 603.329
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1882]]
+
* [[RXN-11322]]
* [[RXN4FS-12]]
 
* [[RXN4FS-13]]
 
* [[RXNQT-4141]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1882]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-β-l-galactose}}
+
{{#set: common-name=aldehydo-d-ribose 5-phosphate}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}}
+
{{#set: inchi-key=inchikey=ppqronhoshzgfq-lmvfsukvsa-l}}
{{#set: molecular-weight=603.329}}
+
{{#set: molecular-weight=228.095}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-15895

  • common-name:
    • aldehydo-d-ribose 5-phosphate
  • smiles:
    • [ch](=o)c(o)c(o)c(cop([o-])([o-])=o)o
  • inchi-key:
    • ppqronhoshzgfq-lmvfsukvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality