Difference between revisions of "SJ04254"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8086 CPD-8086] == * common-name: ** 1-linoleoyl-2-palmitoyl-phosphatidylglycerol * smiles:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N1-METHYLADENINE N1-METHYLADENINE] == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N1-METHYLADENINE N1-METHYLADENINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n1-methyladenine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn2(c=nc1(c(n=cn=1)=c(n)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hpzmwtnatzpbih-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 149.155 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-984]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n1-methyladenine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hpzmwtnatzpbih-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=149.155}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite N1-METHYLADENINE
- common-name:
- n1-methyladenine
- smiles:
- cn2(c=nc1(c(n=cn=1)=c(n)2))
- inchi-key:
- hpzmwtnatzpbih-uhfffaoysa-n
- molecular-weight:
- 149.155
