Difference between revisions of "SJ04318"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-71 CPD-71] == * common-name: ** (25r)-3α,7α,12α-trihydroxy-5β-choles...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == * common-name: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (s)-2,3,4,5-tetrahydrodipicolinate |
* smiles: | * smiles: | ||
− | ** cc | + | ** c1(cc(=nc(c1)c([o-])=o)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cxmbcxqhoxuceo-bypyzucnsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 169.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14246]] |
+ | * [[RXN-7737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14014]] |
+ | * [[RXN-14246]] | ||
+ | * [[RXN-7737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.137}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE
- common-name:
- (s)-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
- inchi-key:
- cxmbcxqhoxuceo-bypyzucnsa-l
- molecular-weight:
- 169.137