Difference between revisions of "SJ04321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o...")
(Created page with "Category:gene == Gene SJ04321 == * transcription-direction: ** positive * right-end-position: ** 462999 * left-end-position: ** 457643 * centisome-position: ** 47.02596...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Gene SJ04321 ==
* common-name:
+
* transcription-direction:
** (r)-nadhx
+
** positive
* smiles:
+
* right-end-position:
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
+
** 462999
* inchi-key:
+
* left-end-position:
** idbzkgqrlbfufq-mtkbybfrsa-l
+
** 457643
* molecular-weight:
+
* centisome-position:
** 681.445
+
** 47.02596   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-12752]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.1.1.127-RXN]]
{{#set: common-name=(r)-nadhx}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=681.445}}
+
* [[RXN-13588]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=462999}}
 +
{{#set: left-end-position=457643}}
 +
{{#set: centisome-position=47.02596    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ04321

  • transcription-direction:
    • positive
  • right-end-position:
    • 462999
  • left-end-position:
    • 457643
  • centisome-position:
    • 47.02596

Organism(s) associated with this gene

Reaction(s) associated