Difference between revisions of "SJ04321"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-DITHIOTHREITOL OXIDIZED-DITHIOTHREITOL] ==
 * common-name:
-** (r)-nadhx
+** oxidized dithiothreitol
 * smiles:
-** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
+** c1(sscc(o)c(o)1)
 * inchi-key:
-** idbzkgqrlbfufq-mtkbybfrsa-l
+** ypgmowhxeqdbbv-imjsidkusa-n
 * molecular-weight:
-** 681.445
+** 152.226
 == Reaction(s) known to consume the compound ==
-* [[RXN-12752]]
+* [[1.1.4.1-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[1.1.4.1-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(r)-nadhx}}
+{{#set: common-name=oxidized dithiothreitol}}
-{{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}}
+{{#set: inchi-key=inchikey=ypgmowhxeqdbbv-imjsidkusa-n}}
-{{#set: molecular-weight=681.445}}
+{{#set: molecular-weight=152.226}}