Difference between revisions of "SJ04334"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * common-name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * smil...")
(Created page with "Category:gene == Gene SJ03262 == * transcription-direction: ** negative * right-end-position: ** 16294 * left-end-position: ** 1656 * centisome-position: ** 1.3455648...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
+
== Gene SJ03262 ==
* common-name:
+
* transcription-direction:
** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 16294
* inchi-key:
+
* left-end-position:
** mntslnsvzacncx-jpddaygwsa-j
+
** 1656
* molecular-weight:
+
* centisome-position:
** 1069.99
+
** 1.3455648   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-16096]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-16095]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=mntslnsvzacncx-jpddaygwsa-j}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=1069.99}}
+
{{#set: right-end-position=16294}}
 +
{{#set: left-end-position=1656}}
 +
{{#set: centisome-position=1.3455648    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ03262

  • transcription-direction:
    • negative
  • right-end-position:
    • 16294
  • left-end-position:
    • 1656
  • centisome-position:
    • 1.3455648

Organism(s) associated with this gene

Reaction(s) associated