Difference between revisions of "SJ04389"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLATE CHOLATE] == * common-name: ** cholate * smiles: ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * common-name: ** n-acetyl-α-d-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-α-d-glucosamine 1-phosphate |
* smiles: | * smiles: | ||
− | ** cc | + | ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fzljpepaypummr-fmdgeedcsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 299.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NAG1P-URIDYLTRANS-RXN]] |
+ | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.3.1.157-RXN]] | ||
+ | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
+ | * [[RXN-16426]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.174}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- common-name:
- n-acetyl-α-d-glucosamine 1-phosphate
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
- inchi-key:
- fzljpepaypummr-fmdgeedcsa-l
- molecular-weight:
- 299.174