Difference between revisions of "SJ04389"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLATE CHOLATE] == * common-name: ** cholate * smiles: ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * common-name: ** n-acetyl-α-d-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLATE CHOLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
 
* common-name:
 
* common-name:
** cholate
+
** n-acetyl-α-d-glucosamine 1-phosphate
 
* smiles:
 
* smiles:
** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](cc(o)c(c)23)4))))
+
** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** bhqcqffyrzlcqq-oeldtzbjsa-m
+
** fzljpepaypummr-fmdgeedcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 407.569
+
** 299.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7-ALPHA-HYDROXYSTEROID-DEH-RXN]]
+
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.1.157-RXN]]
 +
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 +
* [[RXN-16426]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholate}}
+
{{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}}
{{#set: inchi-key=inchikey=bhqcqffyrzlcqq-oeldtzbjsa-m}}
+
{{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}}
{{#set: molecular-weight=407.569}}
+
{{#set: molecular-weight=299.174}}

Revision as of 14:19, 26 August 2019

Metabolite N-ACETYL-D-GLUCOSAMINE-1-P

  • common-name:
    • n-acetyl-α-d-glucosamine 1-phosphate
  • smiles:
    • cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
  • inchi-key:
    • fzljpepaypummr-fmdgeedcsa-l
  • molecular-weight:
    • 299.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality