Difference between revisions of "SJ04468"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)...")
 
(Created page with "Category:gene == Gene SJ04468 == * transcription-direction: ** positive * right-end-position: ** 41936 * left-end-position: ** 11345 * centisome-position: ** 10.640493...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] ==
+
== Gene SJ04468 ==
* common-name:
+
* transcription-direction:
** α-d-ribose-1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
+
** 41936
* inchi-key:
+
* left-end-position:
** yxjdfqjkerbobm-txicztdvsa-l
+
** 11345
* molecular-weight:
+
* centisome-position:
** 228.095
+
** 10.640493   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ADENPHOSPHOR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[INOPHOSPHOR-RXN]]
+
== Reaction(s) associated ==
* [[PNP-RXN]]
+
* [[ARYLSULFAT-RXN]]
* [[PPENTOMUT-RXN]]
+
** Category: [[annotation]]
* [[RXN-14456]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN0-5199]]
+
** Category: [[orthology]]
* [[URPHOS-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=positive}}
* [[ADENPHOSPHOR-RXN]]
+
{{#set: right-end-position=41936}}
* [[INOPHOSPHOR-RXN]]
+
{{#set: left-end-position=11345}}
* [[PNP-RXN]]
+
{{#set: centisome-position=10.640493    }}
* [[PPENTOMUT-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-14456]]
+
{{#set: nb reaction associated=1}}
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-ribose-1-phosphate}}
 
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ04468

  • transcription-direction:
    • positive
  • right-end-position:
    • 41936
  • left-end-position:
    • 11345
  • centisome-position:
    • 10.640493

Organism(s) associated with this gene

Reaction(s) associated