Difference between revisions of "SJ04468"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-6-beta-D-Glucan 1-6-beta-D-Glucan] == * common-name: ** a 1,6-β-d-glucan == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-6-beta-D-Glucan 1-6-beta-D-Glucan] ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** a 1,6-β-d-glucan
* smiles:
 
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 
* inchi-key:
 
** yxjdfqjkerbobm-txicztdvsa-l
 
* molecular-weight:
 
** 228.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPHOSPHOR-RXN]]
+
* [[3.2.1.75-RXN]]
* [[INOPHOSPHOR-RXN]]
 
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENPHOSPHOR-RXN]]
 
* [[INOPHOSPHOR-RXN]]
 
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=a 1,6-β-d-glucan}}
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Revision as of 14:20, 26 August 2019

Metabolite 1-6-beta-D-Glucan

  • common-name:
    • a 1,6-β-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality