Difference between revisions of "SJ04477"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-sn-glycero-3-phosphocholines 1-Alkyl-sn-glycero-3-phosphocholines] ==
 * common-name:
-** oleoyl-coa
+** a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine
-* smiles:
-** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** xduhqpoxluavee-bpmmelmssa-j
-* molecular-weight:
-** 1027.953
 == Reaction(s) known to consume the compound ==
-* [[RXN-13322]]
+* [[2.3.1.149-RXN]]
-* [[RXN-15036]]
+* [[2.3.1.67-RXN]]
-* [[RXN-15043]]
-* [[RXN-15044]]
-* [[RXN-15045]]
-* [[RXN-15090]]
-* [[RXN-17775]]
-* [[RXN-9601]]
-* [[RXN-9666]]
-* [[RXN-9670]]
 == Reaction(s) known to produce the compound ==
-* [[1.14.19.1-RXN]]
+* [[2.3.1.149-RXN]]
-* [[RXN-15036]]
+* [[2.3.1.67-RXN]]
-* [[RXN-9644]]
+* [[3.1.1.47-RXN]]
-* [[RXN-9670]]
-* [[RXN0-7239]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=oleoyl-coa}}
+{{#set: common-name=a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine}}
-{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
-{{#set: molecular-weight=1027.953}}