Difference between revisions of "SJ04484"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * common-name: ** 3-hexapreny...")
 
(Created page with "Category:gene == Gene SJ04484 == * transcription-direction: ** negative * right-end-position: ** 59468 * left-end-position: ** 50621 * centisome-position: ** 47.60834...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] ==
+
== Gene SJ04484 ==
* common-name:
+
* transcription-direction:
** 3-hexaprenyl-4-hydroxybenzoate
+
** negative
* smiles:
+
* right-end-position:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
+
** 59468
* inchi-key:
+
* left-end-position:
** lkmqqqabigihgl-laaqxviisa-m
+
** 50621
* molecular-weight:
+
* centisome-position:
** 545.824
+
** 47.60834   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-9003]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-11840]]
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=545.824}}
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=59468}}
 +
{{#set: left-end-position=50621}}
 +
{{#set: centisome-position=47.60834    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ04484

  • transcription-direction:
    • negative
  • right-end-position:
    • 59468
  • left-end-position:
    • 50621
  • centisome-position:
    • 47.60834

Organism(s) associated with this gene

Reaction(s) associated