Difference between revisions of "SJ04484"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * i...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] == * common-name: ** adp-d-ribose *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] ==
 
* common-name:
 
* common-name:
** l-phenylalanine
+
** adp-d-ribose
 
* smiles:
 
* smiles:
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** colnvldhvkwlrt-qmmmgpobsa-n
+
** srnwougrcwsemx-tyasjmozsa-l
 
* molecular-weight:
 
* molecular-weight:
** 165.191
+
** 557.303
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[ARDP]]
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN0-1441]]
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[RXN-10814]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-phenylalanine}}
+
{{#set: common-name=adp-d-ribose}}
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
{{#set: molecular-weight=165.191}}
+
{{#set: molecular-weight=557.303}}

Revision as of 09:24, 27 August 2019

Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE

  • common-name:
    • adp-d-ribose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
  • inchi-key:
    • srnwougrcwsemx-tyasjmozsa-l
  • molecular-weight:
    • 557.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality