Difference between revisions of "SJ04484"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] == * common-name: ** adp-d-ribose *...")
(Created page with "Category:gene == Gene SJ17347 == * transcription-direction: ** negative * right-end-position: ** 190574 * left-end-position: ** 164536 * centisome-position: ** 62.517952...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] ==
+
== Gene SJ17347 ==
* common-name:
+
* transcription-direction:
** adp-d-ribose
+
** negative
* smiles:
+
* right-end-position:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
+
** 190574
* inchi-key:
+
* left-end-position:
** srnwougrcwsemx-tyasjmozsa-l
+
** 164536
* molecular-weight:
+
* centisome-position:
** 557.303
+
** 62.517952   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ARDP]]
+
* [[S.japonica_sterols_curated]]
* [[RXN0-1441]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=adp-d-ribose}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=557.303}}
+
{{#set: right-end-position=190574}}
 +
{{#set: left-end-position=164536}}
 +
{{#set: centisome-position=62.517952    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ17347

  • transcription-direction:
    • negative
  • right-end-position:
    • 190574
  • left-end-position:
    • 164536
  • centisome-position:
    • 62.517952

Organism(s) associated with this gene

Reaction(s) associated