Difference between revisions of "SJ04559"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-adenine-37 tRNA-adenine-37] ==
 * common-name:
-** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
+** an adenine37 in trna
-* smiles:
-** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
-* inchi-key:
-** notgfiuvdgnkri-uuokfmhzsa-l
-* molecular-weight:
-** 336.197
 == Reaction(s) known to consume the compound ==
-* [[AIAL]]
+* [[RXN-14570]]
-* [[AICARSYN-RXN]]
-* [[AICARTRANSFORM-RXN]]
-* [[FPAIF]]
 == Reaction(s) known to produce the compound ==
-* [[AIAL]]
-* [[AICARSYN-RXN]]
-* [[AICARTRANSFORM-RXN]]
-* [[FPAIF]]
-* [[GLUTAMIDOTRANS-RXN]]
-* [[RXN-14270]]
-* [[RXN-17900]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
+{{#set: common-name=an adenine37 in trna}}
-{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
-{{#set: molecular-weight=336.197}}