Difference between revisions of "SJ04585"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-45-DIHYDROXYBENZOATE 3-HEXAPRENYL-45-DIHYDROXYBENZOATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-with-Uracils DNA-with-Uracils] ==
 * common-name:
-** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
+** a uracil in dna
-* smiles:
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
-* inchi-key:
-** vepicjbqcouqpi-irvxxiiisa-m
-* molecular-weight:
-** 561.823
 == Reaction(s) known to consume the compound ==
-* [[2.1.1.114-RXN]]
+* [[RXN0-2584]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}}
+{{#set: common-name=a uracil in dna}}
-{{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}}
-{{#set: molecular-weight=561.823}}